Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3309 | Purity: >98% |
 | |
| Chemical structure of Fmoc-Val-Cit-PAB-PNP |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Fmoc-V-Cit-PAB-PNP |
|---|---|
| CAS No. | 863971-53-3 |
| Purity | >98% |
| Formula | C40H42N6O10 |
| Mol Weight | 766.7957 |
| CoA | CoA of Fmoc-Val-Cit-PAB-PNP |
| Smiles: | CC(C)[C@@H](C(=O)N[C@@H](CCCNC(=O)N)C(=O)NC1=CC=C(C=C1)COC(=O)OC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
|---|
KEYWORDS: buy Fmoc-Val-Cit-PAB-PNP | Fmoc-Val-Cit-PAB-PNP supplier | purchase | cost | manufacturer | order | distributor | buy 863971-53-3 | 863971-53-3 supplier