Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2596 | Purity: >98% |
 | |
| Chemical structure of Fmoc-Val-Ala-PAB |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1394238-91-5 |
|---|---|
| Purity | >98% |
| Formula | C30H33N3O5 |
| Mol Weight | 515.6001 |
| CoA | CoA of Fmoc-Val-Ala-PAB |
| Smiles: | CC(C)[C@H](NC(=O)OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)C(=O)N[C@@H](C)C(=O)NC1=CC=C(CO)C=C1 |
|---|
KEYWORDS: buy Fmoc-Val-Ala-PAB | Fmoc-Val-Ala-PAB supplier | purchase | cost | manufacturer | order | distributor | buy 1394238-91-5 | 1394238-91-5 supplier