Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3475 | Purity: >98% |
 | |
| Chemical structure of FM 19G11 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | FM19G11 |
|---|---|
| CAS No. | 329932-55-0 |
| Purity | >98% |
| Formula | C23H17N3O8 |
| Mol Weight | 463.3964 |
| CoA | CoA of FM 19G11 |
| Smiles: | CC1=CC=C(C=C1)C(=O)COC(=O)C2=CC(=CC=C2)NC(=O)C3=C(C=C(C=C3)[N+](=O)[O-])[N+](=O)[O-] |
|---|
KEYWORDS: buy FM 19G11 | FM 19G11 supplier | purchase | cost | manufacturer | order | distributor | buy 329932-55-0 | 329932-55-0 supplier