Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3669 | Purity: >98% |
 | |
| Chemical structure of Flurescein-NHS ester |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 890090-41-2 |
|---|---|
| Purity | >98% |
| Formula | C25H15NO9 |
| Mol Weight | 473.3879 |
| Color | orange yellow |
| State | solid |
| Storage | Powder -20℃ 2 years; Dark |
| CoA | CoA of Flurescein-NHS ester |
| Smiles: | C1CC(=O)N(C1=O)OC(=O)C2=CC(=C(C=C2)C(=O)O)C3=C4C=CC(=O)C=C4OC5=C3C=CC(=C5)O |
|---|
KEYWORDS: buy Flurescein-NHS ester | Flurescein-NHS ester supplier | purchase | cost | manufacturer | order | distributor | buy 890090-41-2 | 890090-41-2 supplier