Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2059 | Purity: >98% |
 | |
| Chemical structure of Flumatinib mesylate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 895519-91-2 |
|---|---|
| Purity | >98% |
| Formula | C30H33F3N8O4S |
| Mol Weight | 658.694 |
| CoA | CoA of Flumatinib mesylate |
| Smiles: | CS(O)(=O)=O.CN1CCN(CC2=CC=C(C=C2C(F)(F)F)C(=O)NC2=CC(NC3=NC=CC(=N3)C3=CC=CN=C3)=C(C)N=C2)CC1 |
|---|
KEYWORDS: buy Flumatinib mesylate | Flumatinib mesylate supplier | purchase | cost | manufacturer | order | distributor | buy 895519-91-2 | 895519-91-2 supplier