Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A10627 | Purity: >98% |
 | |
| Chemical structure of flufenerim |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 170015-32-4 |
|---|---|
| Purity | >98% |
| Formula | C15H14ClF4N3O |
| Mol Weight | 363.738 |
| CoA | CoA of flufenerim |
| Smiles: | CC(C1=C(C(=NC=N1)NCCC2=CC=C(C=C2)OC(F)(F)F)Cl)F |
|---|
KEYWORDS: buy flufenerim | flufenerim supplier | purchase | cost | manufacturer | order | distributor | buy 170015-32-4 | 170015-32-4 supplier