Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A294 | Purity: >98% |
 | |
| Chemical structure of FLI-06 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 313967-18-9 |
|---|---|
| Purity | >98% |
| Formula | C25H30N2O5 |
| Mol Weight | 438.5161 |
| CoA | CoA of FLI-06 |
| Smiles: | CC1=C(C(C2=CC=C(C=C2)[N+]([O-])=O)C2=C(CC(C)(C)CC2=O)N1)C(=O)OC1CCCCC1 |
|---|
KEYWORDS: buy FLI-06 | FLI-06 supplier | purchase | cost | manufacturer | order | distributor | buy 313967-18-9 | 313967-18-9 supplier