Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A15480 | Purity: >98% |
 | |
| Chemical structure of FITC Phalloidin |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 915026-99-2 |
|---|---|
| Purity | >98% |
| Formula | C56H60N10O15S2 |
| Mol Weight | 1177.264 |
| CoA | CoA of FITC Phalloidin |
| Smiles: | O=C1OC2(C=3C1=CC(NC(NC[C@](C[C@@H]4NC(=O)[C@@]5(CC=6C=7C(NC6SC[C@](NC(=O)[C@@]([C@H](C)O)(NC(=O)[C@H](C)NC4=O)[H])(C(=O)N8[C@](C(=O)N[C@@H](C)C(=O)N5)(C[C@H](O)C8)[H])[H])=CC=CC7)[H])(C)O)=S)=CC3)C=9C(OC=%10C2=CC=C(O)C%10)=CC(O)=CC9 |
|---|
KEYWORDS: buy FITC Phalloidin | FITC Phalloidin supplier | purchase | cost | manufacturer | order | distributor | buy 915026-99-2 | 915026-99-2 supplier