Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3719 | Purity: >98% |
 | |
| Chemical structure of Firuglipel |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1371591-51-3 |
|---|---|
| Purity | >98% |
| Formula | C25H26FN3O5 |
| Mol Weight | 467.4894 |
| CoA | CoA of Firuglipel |
| Smiles: | CC[C@H](C1=NC(C2=CC(F)=C(C(N[C@H](C)CO)=O)C=C2)=NO1)OC3=CC=C(C(C4CC4)=O)C=C3 |
|---|
KEYWORDS: buy Firuglipel | Firuglipel supplier | purchase | cost | manufacturer | order | distributor | buy 1371591-51-3 | 1371591-51-3 supplier