Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1947 | Purity: >98% |
 | |
| Chemical structure of Finasteride Impurity |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 166896-74-8 |
|---|---|
| Purity | >98% |
| Formula | C23H36N2O2 |
| Mol Weight | 372.5441 |
| CoA | CoA of Finasteride Impurity |
| Smiles: | [H][C@@]12CC[C@H](C(=O)NC(C)(C)C)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2NC(=O)CC[C@]12C |
|---|
KEYWORDS: buy Finasteride Impurity | Finasteride Impurity supplier | purchase | cost | manufacturer | order | distributor | buy 166896-74-8 | 166896-74-8 supplier