Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2334 | Purity: >98% |
 | |
| Chemical structure of FIIN-3 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1637735-84-2 |
|---|---|
| Purity | >98% |
| Formula | C34H36Cl2N8O4 |
| Mol Weight | 691.607 |
| CoA | CoA of FIIN-3 |
| Smiles: | COC1=CC(OC)=C(Cl)C(NC(=O)N(CC2=CC=C(NC(=O)C=C)C=C2)C2=NC=NC(NC3=CC=C(C=C3)N3CCN(C)CC3)=C2)=C1Cl |
|---|
KEYWORDS: buy FIIN-3 | FIIN-3 supplier | purchase | cost | manufacturer | order | distributor | buy 1637735-84-2 | 1637735-84-2 supplier