Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3727 | Purity: >98% |
 | |
| Chemical structure of FD-1080 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1151666-58-8 |
|---|---|
| Purity | >98% |
| Formula | C40H38ClN2NaO6S2 |
| Mol Weight | 765.312 |
| CoA | CoA of FD-1080 |
| Smiles: | C1CC(=C(/C(=C/C=C/2\C3=CC=CC4=C3C(=CC=C4)N2CCCCS(=O)(=O)[O-])/C1)Cl)/C=C/C5=[N+](C6=CC=CC7=C6C5=CC=C7)CCCCS(=O)(=O)[O-].[Na+] |
|---|
KEYWORDS: buy FD-1080 | FD-1080 supplier | purchase | cost | manufacturer | order | distributor | buy 1151666-58-8 | 1151666-58-8 supplier