Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A8182 | Purity: >98% |
 | |
| Chemical structure of F3406 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1115899-15-4 |
|---|---|
| Purity | >98% |
| Formula | C20H21F2N5O3S |
| Mol Weight | 449.474 |
| CoA | CoA of F3406 |
| Smiles: | CCCN1C(=O)C2=C(N=C(S2)N3CCCC3)N(C1=O)CC(=O)NC4=CC(=CC(=C4)F)F |
|---|
KEYWORDS: buy F3406 | F3406 supplier | purchase | cost | manufacturer | order | distributor | buy 1115899-15-4 | 1115899-15-4 supplier