Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3984 | Purity: >98% |
 | |
| Chemical structure of EVP-6124 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 550999-75-2 |
|---|---|
| Purity | >98% |
| Formula | C16H17ClN2OS |
| Mol Weight | 320.837 |
| CoA | CoA of EVP-6124 |
| Smiles: | O=C(C1=CC2=C(C(Cl)=CC=C2)S1)N[C@H]3CN4CCC3CC4 |
|---|
KEYWORDS: buy EVP-6124 | EVP-6124 supplier | purchase | cost | manufacturer | order | distributor | buy 550999-75-2 | 550999-75-2 supplier