Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A12691 | Purity: >97% |
 | |
| Chemical structure of ESi860 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2840537-40-6 |
|---|---|
| Purity | >97% |
| Formula | C42H45Cl2N2Si |
| Mol Weight | 676.812 |
| CoA | CoA of ESi860 |
| Smiles: | ClCCCN1C=2C=CC3=CC4=C(C=C3C2CCC1)[Si](C5=CC=6C(C=CC=7C6CCC[N+]7CCCCl)=CC5=C4C=8C=CC=CC8C)(C)C |
|---|
KEYWORDS: buy ESi860 | ESi860 supplier | purchase | cost | manufacturer | order | distributor | buy 2840537-40-6 | 2840537-40-6 supplier