Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1215 | Purity: >98% |
 | |
| Chemical structure of Eptapirone |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 179756-58-2 |
|---|---|
| Purity | >98% |
| Formula | C16H23N7O2 |
| Mol Weight | 345.3995 |
| CoA | CoA of Eptapirone |
| Smiles: | CN1C(=O)C=NN(CCCCN2CCN(CC2)C2=NC=CC=N2)C1=O |
|---|
KEYWORDS: buy Eptapirone | Eptapirone supplier | purchase | cost | manufacturer | order | distributor | buy 179756-58-2 | 179756-58-2 supplier