Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A14983 | Purity: >98% |
 | |
| Chemical structure of Epicocconone |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Epicocconone |
|---|---|
| CAS No. | 371163-96-1 |
| Purity | >98% |
| Formula | C23H22O7 |
| Mol Weight | 410.4166 |
| CoA | CoA of Epicocconone |
| Smiles: | C/C=C/C=C/C=C/C(=O)/C=C(/C1=C2C=C3C[C@H](OC=C3C(=O)[C@]2(OC1=O)C)CO)\O |
|---|
KEYWORDS: buy Epicocconone | Epicocconone supplier | purchase | cost | manufacturer | order | distributor | buy 371163-96-1 | 371163-96-1 supplier