Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A13844 | Purity: >98% |
 | |
| Chemical structure of EP4 receptor antagonist 3 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1207954-34-4 |
|---|---|
| Purity | >98% |
| Formula | C26H21F3N2O3S |
| Mol Weight | 498.517 |
| CoA | CoA of EP4 receptor antagonist 3 |
| Smiles: | O=C(O)C1=CC=C(C=C1)C2(NC(=O)C3=C(SC=4C=CN(C43)CC5=CC=C(C=C5)C(F)(F)F)C)CC2 |
|---|
KEYWORDS: buy EP4 receptor antagonist 3 | EP4 receptor antagonist 3 supplier | purchase | cost | manufacturer | order | distributor | buy 1207954-34-4 | 1207954-34-4 supplier