Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1130 | Purity: >98% |
 | |
| Chemical structure of Entacapone |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 130929-57-6 |
|---|---|
| Purity | >98% |
| Formula | C14H15N3O5 |
| Mol Weight | 305.286 |
| CoA | CoA of Entacapone |
| Smiles: | CCN(CC)C(=O)C(\C#N)=C\C1=CC(=C(O)C(O)=C1)[N+]([O-])=O |
|---|
KEYWORDS: buy Entacapone | Entacapone supplier | purchase | cost | manufacturer | order | distributor | buy 130929-57-6 | 130929-57-6 supplier