Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2623 | Purity: >98% |
 | |
| Chemical structure of EMA401 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Olodanrigan |
|---|---|
| CAS No. | 1316755-16-4 |
| Purity | >98% |
| Formula | C32H29NO5 |
| Mol Weight | 507.5764 |
| CoA | CoA of EMA401 |
| Smiles: | COC1=C(OCC2=CC=CC=C2)C2=C(CN([C@@H](C2)C(O)=O)C(=O)C(C2=CC=CC=C2)C2=CC=CC=C2)C=C1 |
|---|
KEYWORDS: buy EMA401 | EMA401 supplier | purchase | cost | manufacturer | order | distributor | buy 1316755-16-4 | 1316755-16-4 supplier