Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A779 | Purity: >98% |
 | |
| Chemical structure of EHop-016 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1380432-32-5 |
|---|---|
| Purity | >98% |
| Formula | C25H30N6O |
| Mol Weight | 430.5453 |
| CoA | CoA of EHop-016 |
| Smiles: | CCN1C2=C(C=CC=C2)C2=C1C=CC(NC1=NC(NCCCN3CCOCC3)=NC=C1)=C2 |
|---|
KEYWORDS: buy EHop-016 | EHop-016 supplier | purchase | cost | manufacturer | order | distributor | buy 1380432-32-5 | 1380432-32-5 supplier