Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A13538 | Purity: >98% |
 | |
| Chemical structure of EFGNTLEDK |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 842160-77-4 |
|---|---|
| Purity | >98% |
| Formula | C45H69N11O18 |
| Mol Weight | 1052.0923 |
| CoA | CoA of EFGNTLEDK |
| Smiles: | [C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC(CNC([C@H](CC1=CC=CC=C1)NC([C@H](CCC(O)=O)N)=O)=O)=O)CC(N)=O)=O)[C@@H](C)O)=O)CC(C)C)=O)(C(N[C@H](C(N[C@@H](CCCCN)C(O)=O)=O)CC(O)=O)=O)CCC(O)=O |
|---|
KEYWORDS: buy EFGNTLEDK | EFGNTLEDK supplier | purchase | cost | manufacturer | order | distributor | buy 842160-77-4 | 842160-77-4 supplier