Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A830 | Purity: >98% |
 | |
| Chemical structure of E7050 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Golvatinib |
|---|---|
| CAS No. | 928037-13-2 |
| Purity | >98% |
| Formula | C33H37F2N7O4 |
| Mol Weight | 633.6882 |
| CoA | CoA of E7050 |
| Smiles: | CN1CCN(CC1)C1CCN(CC1)C(=O)NC1=NC=CC(OC2=CC(F)=C(NC(=O)C3(CC3)C(=O)NC3=CC=C(F)C=C3)C=C2)=C1 |
|---|
KEYWORDS: buy E7050 | E7050 supplier | purchase | cost | manufacturer | order | distributor | buy 928037-13-2 | 928037-13-2 supplier