Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3860 | Purity: >98% |
 | |
| Chemical structure of E3 Ligase Ligand-Linker Conjugates 20 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1950635-15-0 |
|---|---|
| Purity | >98% |
| Formula | C23H30N4O6 |
| Mol Weight | 458.5075 |
| CoA | CoA of E3 Ligase Ligand-Linker Conjugates 20 |
| Smiles: | NCCCCCCCCNC(COC1=C(C(N2C(CCC3=O)C(N3)=O)=O)C(C2=O)=CC=C1)=O |
|---|
KEYWORDS: buy E3 Ligase Ligand-Linker Conjugates 20 | E3 Ligase Ligand-Linker Conjugates 20 supplier | purchase | cost | manufacturer | order | distributor | buy 1950635-15-0 | 1950635-15-0 supplier