Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3942 | Purity: >98% |
 | |
| Chemical structure of E3 ligase Ligand-Linker Conjugates 15 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Thalidomide-O-amido-C3-COOH |
|---|---|
| CAS No. | 2308035-51-8 |
| Purity | >98% |
| Formula | C19H19N3O8 |
| Mol Weight | 417.3695 |
| CoA | CoA of E3 ligase Ligand-Linker Conjugates 15 |
| Smiles: | O=C(N(C(CCC1=O)C(N1)=O)C2=O)C(C2=CC=C3)=C3OCC(NCCCC(O)=O)=O |
|---|
KEYWORDS: buy E3 ligase Ligand-Linker Conjugates 15 | E3 ligase Ligand-Linker Conjugates 15 supplier | purchase | cost | manufacturer | order | distributor | buy 2308035-51-8 | 2308035-51-8 supplier