Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A121 | Purity: >98% |
 | |
| Chemical structure of DY131 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 95167-41-2 |
|---|---|
| Purity | >98% |
| Formula | C18H21N3O2 |
| Mol Weight | 311.3782 |
| CoA | CoA of DY131 |
| Smiles: | CCN(CC)C1=CC=C(C=C1)\C=N\NC(=O)C1=CC=C(O)C=C1 |
|---|
KEYWORDS: buy DY131 | DY131 supplier | purchase | cost | manufacturer | order | distributor | buy 95167-41-2 | 95167-41-2 supplier