Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3571 | Purity: >98% |
 | |
| Chemical structure of DSM265 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1282041-94-4 |
|---|---|
| Purity | >98% |
| Formula | C14H12F7N5S |
| Mol Weight | 415.332 |
| CoA | CoA of DSM265 |
| Smiles: | CC1=NC2=NC(C(C)(F)F)=NN2C(NC3=CC=C(S(F)(F)(F)(F)F)C=C3)=C1 |
|---|
KEYWORDS: buy DSM265 | DSM265 supplier | purchase | cost | manufacturer | order | distributor | buy 1282041-94-4 | 1282041-94-4 supplier