Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9692 | Purity: >98% |
 | |
| Chemical structure of DOTAM-PSMA 617 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2414406-16-7 |
|---|---|
| Purity | >98% |
| Formula | C49H74N12O13 |
| Mol Weight | 1039.1844 |
| CoA | CoA of DOTAM-PSMA 617 |
| Smiles: | C([C@H](NC(=O)[C@H]1CC[C@H](CNC(CN2CCN(CC(N)=O)CCN(CC(N)=O)CCN(CC(N)=O)CC2)=O)CC1)C(NCCCC[C@H](NC(N[C@@H](CCC(O)=O)C(O)=O)=O)C(O)=O)=O)C3=CC4=C(C=C3)C=CC=C4 |
|---|
KEYWORDS: buy DOTAM-PSMA 617 | DOTAM-PSMA 617 supplier | purchase | cost | manufacturer | order | distributor | buy 2414406-16-7 | 2414406-16-7 supplier