Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3017 | Purity: >98% |
 | |
| Chemical structure of DJ-V-159 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2253744-53-3 |
|---|---|
| Purity | >98% |
| Formula | C24H12F6N4O2 |
| Mol Weight | 502.3681 |
| CoA | CoA of DJ-V-159 |
| Smiles: | FC(F)(F)C1=C(C=CC(NC(=O)C2=CC(=CC=C2)C(=O)NC2=CC(=C(C=C2)C#N)C(F)(F)F)=C1)C#N |
|---|
KEYWORDS: buy DJ-V-159 | DJ-V-159 supplier | purchase | cost | manufacturer | order | distributor | buy 2253744-53-3 | 2253744-53-3 supplier