Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9546 | Purity: >98% |
 | |
| Chemical structure of DIV17E5 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Purity | >98% |
|---|---|
| Formula | C16H11BrClN3O |
| Mol Weight | 376.635 |
| CoA | CoA of DIV17E5 |
| Smiles: | OC1=CC=C(C=C1)C1=NC(NC2=CC=C(Br)C(Cl)=C2)=CN=C1 |
|---|
KEYWORDS: buy DIV17E5 | DIV17E5 supplier | purchase | cost | manufacturer | order | distributor | buy | supplier