Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16793 | Purity: >98% |
 | |
| Chemical structure of DiFMU-α-Gal |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2571070-06-7 |
|---|---|
| Purity | >98% |
| Formula | C16H16F2O8 |
| Mol Weight | 374.2902 |
| CoA | CoA of DiFMU-α-Gal |
| Smiles: | FC1=C2C(=CC(F)=C1O[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(C)=CC(=O)O2 |
|---|
KEYWORDS: buy DiFMU-α-Gal | DiFMU-α-Gal supplier | purchase | cost | manufacturer | order | distributor | buy 2571070-06-7 | 2571070-06-7 supplier