Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16566 | Purity: >98% |
 | |
| Chemical structure of diAcCA |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 3650-24-6 |
|---|---|
| Purity | >98% |
| Formula | C24H32O6 |
| Mol Weight | 416.5073 |
| CoA | CoA of diAcCA |
| Smiles: | C(O)(=O)[C@@]12C3=C(OC(C)=O)C(OC(C)=O)=C(C(C)C)C=C3CC[C@]1(C(C)(C)CCC2)[H] |
|---|
KEYWORDS: buy diAcCA | diAcCA supplier | purchase | cost | manufacturer | order | distributor | buy 3650-24-6 | 3650-24-6 supplier