Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3469 | Purity: >98% |
 | |
| Chemical structure of DG172 dihydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1361504-77-9 |
|---|---|
| Purity | >98% |
| Formula | C20H22BrCl2N3 |
| Mol Weight | 455.219 |
| CoA | CoA of DG172 dihydrochloride |
| Smiles: | BrC(C=CC=C1)=C1/C(C#N)=C/C(C=C2)=CC=C2N3CCN(C)CC3.[H]Cl.[H]Cl |
|---|
KEYWORDS: buy DG172 dihydrochloride | DG172 dihydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 1361504-77-9 | 1361504-77-9 supplier