Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A398 | Purity: >98% |
 | |
| Chemical structure of Dexpramipexole dihydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 104632-27-1 |
|---|---|
| Purity | >98% |
| Formula | C10H19Cl2N3S |
| Mol Weight | 284.249 |
| CoA | CoA of Dexpramipexole dihydrochloride |
| Smiles: | Cl.Cl.CCCN[C@@H]1CCC2=C(C1)SC(N)=N2 |
|---|
KEYWORDS: buy Dexpramipexole dihydrochloride | Dexpramipexole dihydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 104632-27-1 | 104632-27-1 supplier