Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A11765 | Purity: >98% |
 | |
| Chemical structure of Demethoxyeuphorblin R |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 54662-31-6 |
|---|---|
| Purity | >98% |
| Formula | C34H42O10 |
| Mol Weight | 610.6913 |
| CoA | CoA of Demethoxyeuphorblin R |
| Smiles: | O=C(OC1C(OC(=O)CC=2C=CC=CC2)C(=CC34OC4(C(=O)C(C)C(OC(=O)C)C5C1C5(C)C)CC(C)C3OC(=O)C)C)C |
|---|
KEYWORDS: buy Demethoxyeuphorblin R | Demethoxyeuphorblin R supplier | purchase | cost | manufacturer | order | distributor | buy 54662-31-6 | 54662-31-6 supplier