Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3992 | Purity: >98% |
 | |
| Chemical structure of Delafloxacin meglumine |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 352458-37-8 |
|---|---|
| Purity | >98% |
| Formula | C25H29ClF3N5O9 |
| Mol Weight | 635.974 |
| CoA | CoA of Delafloxacin meglumine |
| Smiles: | O=C(C1=CN(C2=NC(N)=C(F)C=C2F)C3=C(C=C(F)C(N4CC(O)C4)=C3Cl)C1=O)O.O[C@H]([C@H]([C@@H]([C@@H](CO)O)O)O)CNC |
|---|
KEYWORDS: buy Delafloxacin meglumine | Delafloxacin meglumine supplier | purchase | cost | manufacturer | order | distributor | buy 352458-37-8 | 352458-37-8 supplier