Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2048 | Purity: >98% |
 | |
| Chemical structure of Degrasyn |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | WP1130 |
|---|---|
| CAS No. | 856243-80-6 |
| Purity | >98% |
| Formula | C19H18BrN3O |
| Mol Weight | 384.27 |
| CoA | CoA of Degrasyn |
| Smiles: | CCC[C@H](NC(=O)C(=C\C1=NC(Br)=CC=C1)\C#N)C1=CC=CC=C1 |
|---|
KEYWORDS: buy Degrasyn | Degrasyn supplier | purchase | cost | manufacturer | order | distributor | buy 856243-80-6 | 856243-80-6 supplier