Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4085 | Purity: >98% |
 | |
| Chemical structure of Deferoxamine mesylate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 138-14-7 |
|---|---|
| Purity | >98% |
| Formula | C26H52N6O11S |
| Mol Weight | 656.79 |
| CoA | CoA of Deferoxamine mesylate |
| Smiles: | O=C(N(CCCCCN)O)CCC(NCCCCCN(C(CCC(NCCCCCN(C(C)=O)O)=O)=O)O)=O.CS(=O)(O)=O |
|---|
KEYWORDS: buy Deferoxamine mesylate | Deferoxamine mesylate supplier | purchase | cost | manufacturer | order | distributor | buy 138-14-7 | 138-14-7 supplier