Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4017 | Purity: >98% |
 | |
| Chemical structure of Decogluran |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 911115-16-7 |
|---|---|
| Purity | >98% |
| Formula | C21H11F6N5 |
| Mol Weight | 447.336 |
| CoA | CoA of Decogluran |
| Smiles: | NC1=NC=C(C#CC2=C3N=C(C4=CC=C(C(F)(F)F)C=C4)C=C(C(F)(F)F)N3N=C2)C=C1 |
|---|
KEYWORDS: buy Decogluran | Decogluran supplier | purchase | cost | manufacturer | order | distributor | buy 911115-16-7 | 911115-16-7 supplier