Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1580 | Purity: >98% |
 | |
| Chemical structure of Decernotinib |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | VX-509 |
|---|---|
| CAS No. | 944842-54-0 |
| Purity | >98% |
| Formula | C18H19F3N6O |
| Mol Weight | 392.3783 |
| CoA | CoA of Decernotinib |
| Smiles: | CC[C@@](C)(NC1=NC(=NC=C1)C1=CNC2=C1C=CC=N2)C(=O)NCC(F)(F)F |
|---|
KEYWORDS: buy Decernotinib | Decernotinib supplier | purchase | cost | manufacturer | order | distributor | buy 944842-54-0 | 944842-54-0 supplier