Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9031C | Purity: >98% |
 | |
| Chemical structure of ddTTP |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Dideoxy-ttp |
|---|---|
| CAS No. | 611-60-9 |
| Purity | >98% |
| Formula | C10H17N2O13P3 |
| Mol Weight | 466.1689 |
| CoA | CoA of ddTTP |
| Smiles: | CC1=CN(C(=O)NC1=O)[C@H]2CC[C@H](O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
|---|
KEYWORDS: buy ddTTP | ddTTP supplier | purchase | cost | manufacturer | order | distributor | buy 611-60-9 | 611-60-9 supplier