Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1935 | Purity: >98% |
 | |
| Chemical structure of DDP-38003 dihydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1831167-98-6 |
|---|---|
| Purity | >98% |
| Formula | C21H28Cl2N4O |
| Mol Weight | 423.379 |
| CoA | CoA of DDP-38003 dihydrochloride |
| Smiles: | Cl[H].Cl[H].CN1CCN(CC1)C1=CC=C(C=C1)C(=O)NC1=CC=C(C=C1)[C@@H]1C[C@H]1N |
|---|
KEYWORDS: buy DDP-38003 dihydrochloride | DDP-38003 dihydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 1831167-98-6 | 1831167-98-6 supplier