Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2047 | Purity: >98% |
 | |
| Chemical structure of DCC-2618 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | c-Kit-IN-1 |
|---|---|
| CAS No. | 1225278-16-9 |
| Purity | >98% |
| Formula | C26H21F2N5O3 |
| Mol Weight | 489.4734 |
| CoA | CoA of DCC-2618 |
| Smiles: | CN1C=C(C=N1)C1=CC(OC2=C(F)C=C(NC(=O)C3(CC3)C(=O)NC3=CC=CC=C3)C(F)=C2)=CC=N1 |
|---|
KEYWORDS: buy DCC-2618 | DCC-2618 supplier | purchase | cost | manufacturer | order | distributor | buy 1225278-16-9 | 1225278-16-9 supplier