Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4070 | Purity: >98% |
 | |
| Chemical structure of DCBA |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 72236-23-8 |
|---|---|
| Purity | >98% |
| Formula | C12H15NO3 |
| Mol Weight | 221.2524 |
| CoA | CoA of DCBA |
| Smiles: | O=C(O)C1=CC=CC(C(N(CC)CC)=O)=C1 |
|---|
KEYWORDS: buy DCBA | DCBA supplier | purchase | cost | manufacturer | order | distributor | buy 72236-23-8 | 72236-23-8 supplier