Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2963 | Purity: >98% |
 | |
| Chemical structure of DC661 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1872387-43-3 |
|---|---|
| Purity | >98% |
| Formula | C31H39Cl2N5 |
| Mol Weight | 552.581 |
| CoA | CoA of DC661 |
| Smiles: | CN(CCCCCCNC1=CC=NC2=CC(Cl)=CC=C12)CCCCCCNC1=CC=NC2=CC(Cl)=CC=C12 |
|---|
KEYWORDS: buy DC661 | DC661 supplier | purchase | cost | manufacturer | order | distributor | buy 1872387-43-3 | 1872387-43-3 supplier