Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A679 | Purity: >98% |
 | |
| Chemical structure of DBeQ |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 177355-84-9 |
|---|---|
| Purity | >98% |
| Formula | C22H20N4 |
| Mol Weight | 340.421 |
| CoA | CoA of DBeQ |
| Smiles: | C(NC1=NC2=CC=CC=C2C(NCC2=CC=CC=C2)=N1)C1=CC=CC=C1 |
|---|
KEYWORDS: buy DBeQ | DBeQ supplier | purchase | cost | manufacturer | order | distributor | buy 177355-84-9 | 177355-84-9 supplier