Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9946C | Purity: >98% |
 | |
| Chemical structure of DBCO-NHCO-PEG5-Amine |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1839510-59-6 |
|---|---|
| Purity | >98% |
| Formula | C31H41N3O7 |
| Mol Weight | 567.6731 |
| CoA | CoA of DBCO-NHCO-PEG5-Amine |
| Smiles: | O=C(NCCC(=O)N1C=2C=CC=CC2C#CC=3C=CC=CC3C1)CCOCCOCCOCCOCCOCCN |
|---|
KEYWORDS: buy DBCO-NHCO-PEG5-Amine | DBCO-NHCO-PEG5-Amine supplier | purchase | cost | manufacturer | order | distributor | buy 1839510-59-6 | 1839510-59-6 supplier