Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4970 | Purity: >98% |
 | |
| Chemical structure of Dafadine-A |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Dafadine A |
|---|---|
| CAS No. | 1065506-69-5 |
| Purity | >98% |
| Formula | C23H25N3O3 |
| Mol Weight | 391.4629 |
| CoA | CoA of Dafadine-A |
| Smiles: | CC1=C(C(=CC=C1)C)OCC2=CC(=NO2)C(=O)N3CCC(CC3)C4=CC=NC=C4 |
|---|
KEYWORDS: buy Dafadine-A | Dafadine-A supplier | purchase | cost | manufacturer | order | distributor | buy 1065506-69-5 | 1065506-69-5 supplier