Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A13976G | Purity: >98% |
 | |
| Chemical structure of Dabigatran ethyl ester benzenesulfonate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1643773-80-1 |
|---|---|
| Purity | >98% |
| Formula | C33H35N7O6S |
| Mol Weight | 657.739 |
| CoA | CoA of Dabigatran ethyl ester benzenesulfonate |
| Smiles: | O=C(OCC)CCN(C(=O)C=1C=CC2=C(N=C(N2C)CNC3=CC=C(C=C3)C(=N)N)C1)C4=NC=CC=C4.O=S(=O)(O)C=1C=CC=CC1 |
|---|
KEYWORDS: buy Dabigatran ethyl ester benzenesulfonate | Dabigatran ethyl ester benzenesulfonate supplier | purchase | cost | manufacturer | order | distributor | buy 1643773-80-1 | 1643773-80-1 supplier