Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A13438G | Purity: >98% |
 | |
| Chemical structure of D-Norleucine, 3-propyl- |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2350088-13-8 |
|---|---|
| Purity | >98% |
| Formula | C9H19NO2 |
| Mol Weight | 173.2527 |
| CoA | CoA of D-Norleucine, 3-propyl- |
| Smiles: | C([C@H](C(O)=O)N)(CCC)CCC |
|---|
KEYWORDS: buy D-Norleucine, 3-propyl- | D-Norleucine, 3-propyl- supplier | purchase | cost | manufacturer | order | distributor | buy 2350088-13-8 | 2350088-13-8 supplier